C10H12BrFN2O2 — CID 106667362
1-(2-amino-5-bromo-4-fluorophenyl)pyrrolidine-3,4-diol (PubChem CID 106667362) has the molecular formula C10H12BrFN2O2 and a molecular weight of 291.12 g/mol. Its IUPAC name is 1-(2-amino-5-bromo-4-fluorophenyl)pyrrolidine-3,4-diol.
| Compound Name | 1-(2-amino-5-bromo-4-fluorophenyl)pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 106667362 |
| Molecular Formula | C10H12BrFN2O2 |
| Molecular Weight | 291.12 g/mol |
| Exact Mass | 290.01 |
| IUPAC Name | 1-(2-amino-5-bromo-4-fluorophenyl)pyrrolidine-3,4-diol |
| SMILES | Nc1cc(F)c(Br)cc1N1CC(O)C(O)C1 |
| InChI | InChI=1S/C10H12BrFN2O2/c11-5-1-8(7(13)2-6(5)12)14-3-9(15)10(16)4-14/h1-2,9-10,15-16H,3-4,13H2 |
| InChIKey | SVZQAFUPNZPBHE-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.12 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|