C22H40O4 — CID 10666743
tert-butyl (6R)-8-[(4S,6R)-2,2-dimethyl-6-prop-2-enyl-1,3-dioxan-4-yl]-6-methyloctanoate (PubChem CID 10666743) has the molecular formula C22H40O4 and a molecular weight of 368.56 g/mol. Its IUPAC name is tert-butyl (6R)-8-[(4S,6R)-2,2-dimethyl-6-prop-2-enyl-1,3-dioxan-4-yl]-6-methyloctanoate.
| Compound Name | tert-butyl (6R)-8-[(4S,6R)-2,2-dimethyl-6-prop-2-enyl-1,3-dioxan-4-yl]-6-methyloctanoate |
|---|---|
| PubChem CID | 10666743 |
| Molecular Formula | C22H40O4 |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.29 |
| IUPAC Name | tert-butyl (6R)-8-[(4S,6R)-2,2-dimethyl-6-prop-2-enyl-1,3-dioxan-4-yl]-6-methyloctanoate |
| SMILES | C=CC[C@@H]1C[C@H](CC[C@H](C)CCCCC(=O)OC(C)(C)C)OC(C)(C)O1 |
| InChI | InChI=1S/C22H40O4/c1-8-11-18-16-19(25-22(6,7)24-18)15-14-17(2)12-9-10-13-20(23)26-21(3,4)5/h8,17-19H,1,9-16H2,2-7H3/t17-,18-,19+/m1/s1 |
| InChIKey | LFNBEVQJZKSJFL-QRVBRYPASA-N |
| XLogP | 5.79 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|