C15H24N2O2 — CID 106667892
1-[2-amino-1-(3-methylphenyl)butyl]pyrrolidine-3,4-diol (PubChem CID 106667892) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 1-[2-amino-1-(3-methylphenyl)butyl]pyrrolidine-3,4-diol.
| Compound Name | 1-[2-amino-1-(3-methylphenyl)butyl]pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 106667892 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | 1-[2-amino-1-(3-methylphenyl)butyl]pyrrolidine-3,4-diol |
| SMILES | CCC(N)C(c1cccc(C)c1)N1CC(O)C(O)C1 |
| InChI | InChI=1S/C15H24N2O2/c1-3-12(16)15(11-6-4-5-10(2)7-11)17-8-13(18)14(19)9-17/h4-7,12-15,18-19H,3,8-9,16H2,1-2H3 |
| InChIKey | WBRNWGNGNUVWDE-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |