About N-[3,5-bis(trifluoromethyl)phenyl]-6-chloropyridazine-3-carboxamide
N-[3,5-bis(trifluoromethyl)phenyl]-6-chloropyridazine-3-carboxamide (PubChem CID 10666814) has the molecular formula C13H6ClF6N3O
and a molecular weight of 369.65 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-6-chloropyridazine-3-carboxamide.
Molecular Properties
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-6-chloropyridazine-3-carboxamide |
| PubChem CID | 10666814 |
| Molecular Formula | C13H6ClF6N3O |
| Molecular Weight | 369.65 g/mol |
| Exact Mass | 369.01 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-6-chloropyridazine-3-carboxamide |
| SMILES | O=C(Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccc(Cl)nn1 |
| InChI | InChI=1S/C13H6ClF6N3O/c14-10-2-1-9(22-23-10)11(24)21-8-4-6(12(15,16)17)3-7(5-8)13(18,19)20/h1-5H,(H,21,24) |
| InChIKey | KTVJBKNOZYURGN-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.65 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[3,5-bis(trifluoromethyl)phenyl]-6-chloropyridazine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3,5-bis(trifluoromethyl)phenyl]-6-chloropyridazine-3-carboxamide?
The IUPAC name of N-[3,5-bis(trifluoromethyl)phenyl]-6-chloropyridazine-3-carboxamide (CID 10666814) is N-[3,5-bis(trifluoromethyl)phenyl]-6-chloropyridazine-3-carboxamide.
What is the SMILES notation for N-[3,5-bis(trifluoromethyl)phenyl]-6-chloropyridazine-3-carboxamide?
The canonical SMILES for N-[3,5-bis(trifluoromethyl)phenyl]-6-chloropyridazine-3-carboxamide is O=C(Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccc(Cl)nn1.
What is the InChIKey of N-[3,5-bis(trifluoromethyl)phenyl]-6-chloropyridazine-3-carboxamide?
The InChIKey is KTVJBKNOZYURGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H6ClF6N3O/c14-10-2-1-9(22-23-10)11(24)21-8-4-6(12(15,16)17)3-7(5-8)13(18,19)20/h1-5H,(H,21,24).
What are the key properties of N-[3,5-bis(trifluoromethyl)phenyl]-6-chloropyridazine-3-carboxamide?
N-[3,5-bis(trifluoromethyl)phenyl]-6-chloropyridazine-3-carboxamide has a molecular weight of 369.65 g/mol, XLogP of 4.42, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3,5-bis(trifluoromethyl)phenyl]-6-chloropyridazine-3-carboxamide is sourced from PubChem (CID 10666814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).