About N-(2-cyanophenyl)-4-(3,4-dihydroxypyrrolidin-1-yl)butanamide
N-(2-cyanophenyl)-4-(3,4-dihydroxypyrrolidin-1-yl)butanamide (PubChem CID 106669459) has the molecular formula C15H19N3O3
and a molecular weight of 289.33 g/mol. Its IUPAC name is N-(2-cyanophenyl)-4-(3,4-dihydroxypyrrolidin-1-yl)butanamide.
Molecular Properties
| Compound Name | N-(2-cyanophenyl)-4-(3,4-dihydroxypyrrolidin-1-yl)butanamide |
| PubChem CID | 106669459 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | N-(2-cyanophenyl)-4-(3,4-dihydroxypyrrolidin-1-yl)butanamide |
| SMILES | N#Cc1ccccc1NC(=O)CCCN1CC(O)C(O)C1 |
| InChI | InChI=1S/C15H19N3O3/c16-8-11-4-1-2-5-12(11)17-15(21)6-3-7-18-9-13(19)14(20)10-18/h1-2,4-5,13-14,19-20H,3,6-7,9-10H2,(H,17,21) |
| InChIKey | YSPIOBNCCSNJGS-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 96.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(2-cyanophenyl)-4-(3,4-dihydroxypyrrolidin-1-yl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-cyanophenyl)-4-(3,4-dihydroxypyrrolidin-1-yl)butanamide?
The IUPAC name of N-(2-cyanophenyl)-4-(3,4-dihydroxypyrrolidin-1-yl)butanamide (CID 106669459) is N-(2-cyanophenyl)-4-(3,4-dihydroxypyrrolidin-1-yl)butanamide.
What is the SMILES notation for N-(2-cyanophenyl)-4-(3,4-dihydroxypyrrolidin-1-yl)butanamide?
The canonical SMILES for N-(2-cyanophenyl)-4-(3,4-dihydroxypyrrolidin-1-yl)butanamide is N#Cc1ccccc1NC(=O)CCCN1CC(O)C(O)C1.
What is the InChIKey of N-(2-cyanophenyl)-4-(3,4-dihydroxypyrrolidin-1-yl)butanamide?
The InChIKey is YSPIOBNCCSNJGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3O3/c16-8-11-4-1-2-5-12(11)17-15(21)6-3-7-18-9-13(19)14(20)10-18/h1-2,4-5,13-14,19-20H,3,6-7,9-10H2,(H,17,21).
What are the key properties of N-(2-cyanophenyl)-4-(3,4-dihydroxypyrrolidin-1-yl)butanamide?
N-(2-cyanophenyl)-4-(3,4-dihydroxypyrrolidin-1-yl)butanamide has a molecular weight of 289.33 g/mol, XLogP of 0.31, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-cyanophenyl)-4-(3,4-dihydroxypyrrolidin-1-yl)butanamide is sourced from PubChem (CID 106669459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).