C15H19N3O3 — CID 106669459
N-(2-cyanophenyl)-4-(3,4-dihydroxypyrrolidin-1-yl)butanamide (PubChem CID 106669459) has the molecular formula C15H19N3O3 and a molecular weight of 289.33 g/mol. Its IUPAC name is N-(2-cyanophenyl)-4-(3,4-dihydroxypyrrolidin-1-yl)butanamide.
| Compound Name | N-(2-cyanophenyl)-4-(3,4-dihydroxypyrrolidin-1-yl)butanamide |
|---|---|
| PubChem CID | 106669459 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | N-(2-cyanophenyl)-4-(3,4-dihydroxypyrrolidin-1-yl)butanamide |
| SMILES | N#Cc1ccccc1NC(=O)CCCN1CC(O)C(O)C1 |
| InChI | InChI=1S/C15H19N3O3/c16-8-11-4-1-2-5-12(11)17-15(21)6-3-7-18-9-13(19)14(20)10-18/h1-2,4-5,13-14,19-20H,3,6-7,9-10H2,(H,17,21) |
| InChIKey | YSPIOBNCCSNJGS-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 96.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |