C8H13F3N2O2S — CID 106669595
2-[(3,4-dihydroxypyrrolidin-1-yl)methyl]-3,3,3-trifluoropropanethioamide (PubChem CID 106669595) has the molecular formula C8H13F3N2O2S and a molecular weight of 258.26 g/mol. Its IUPAC name is 2-[(3,4-dihydroxypyrrolidin-1-yl)methyl]-3,3,3-trifluoropropanethioamide.
| Compound Name | 2-[(3,4-dihydroxypyrrolidin-1-yl)methyl]-3,3,3-trifluoropropanethioamide |
|---|---|
| PubChem CID | 106669595 |
| Molecular Formula | C8H13F3N2O2S |
| Molecular Weight | 258.26 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 2-[(3,4-dihydroxypyrrolidin-1-yl)methyl]-3,3,3-trifluoropropanethioamide |
| SMILES | NC(=S)C(CN1CC(O)C(O)C1)C(F)(F)F |
| InChI | InChI=1S/C8H13F3N2O2S/c9-8(10,11)4(7(12)16)1-13-2-5(14)6(15)3-13/h4-6,14-15H,1-3H2,(H2,12,16) |
| InChIKey | LNDWKOMPZRIJRB-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.26 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|