About 4-(3,4-dihydroxypyrrolidin-1-yl)-N'-hydroxybutanimidamide
4-(3,4-dihydroxypyrrolidin-1-yl)-N'-hydroxybutanimidamide (PubChem CID 106669731) has the molecular formula C8H17N3O3
and a molecular weight of 203.24 g/mol. Its IUPAC name is 4-(3,4-dihydroxypyrrolidin-1-yl)-N'-hydroxybutanimidamide.
Molecular Properties
| Compound Name | 4-(3,4-dihydroxypyrrolidin-1-yl)-N'-hydroxybutanimidamide |
| PubChem CID | 106669731 |
| Molecular Formula | C8H17N3O3 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 4-(3,4-dihydroxypyrrolidin-1-yl)-N'-hydroxybutanimidamide |
| SMILES | NC(CCCN1CC(O)C(O)C1)=NO |
| InChI | InChI=1S/C8H17N3O3/c9-8(10-14)2-1-3-11-4-6(12)7(13)5-11/h6-7,12-14H,1-5H2,(H2,9,10) |
| InChIKey | LXNYBOGQDMOCRV-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 102.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(3,4-dihydroxypyrrolidin-1-yl)-N'-hydroxybutanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,4-dihydroxypyrrolidin-1-yl)-N'-hydroxybutanimidamide?
The IUPAC name of 4-(3,4-dihydroxypyrrolidin-1-yl)-N'-hydroxybutanimidamide (CID 106669731) is 4-(3,4-dihydroxypyrrolidin-1-yl)-N'-hydroxybutanimidamide.
What is the SMILES notation for 4-(3,4-dihydroxypyrrolidin-1-yl)-N'-hydroxybutanimidamide?
The canonical SMILES for 4-(3,4-dihydroxypyrrolidin-1-yl)-N'-hydroxybutanimidamide is NC(CCCN1CC(O)C(O)C1)=NO.
What is the InChIKey of 4-(3,4-dihydroxypyrrolidin-1-yl)-N'-hydroxybutanimidamide?
The InChIKey is LXNYBOGQDMOCRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N3O3/c9-8(10-14)2-1-3-11-4-6(12)7(13)5-11/h6-7,12-14H,1-5H2,(H2,9,10).
What are the key properties of 4-(3,4-dihydroxypyrrolidin-1-yl)-N'-hydroxybutanimidamide?
4-(3,4-dihydroxypyrrolidin-1-yl)-N'-hydroxybutanimidamide has a molecular weight of 203.24 g/mol, XLogP of -1.45, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-dihydroxypyrrolidin-1-yl)-N'-hydroxybutanimidamide is sourced from PubChem (CID 106669731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).