C11H14ClN3O2 — CID 106669767
3-chloro-4-(3,4-dihydroxypyrrolidin-1-yl)benzenecarboximidamide (PubChem CID 106669767) has the molecular formula C11H14ClN3O2 and a molecular weight of 255.71 g/mol. Its IUPAC name is 3-chloro-4-(3,4-dihydroxypyrrolidin-1-yl)benzenecarboximidamide.
| Compound Name | 3-chloro-4-(3,4-dihydroxypyrrolidin-1-yl)benzenecarboximidamide |
|---|---|
| PubChem CID | 106669767 |
| Molecular Formula | C11H14ClN3O2 |
| Molecular Weight | 255.71 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | 3-chloro-4-(3,4-dihydroxypyrrolidin-1-yl)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(N2CC(O)C(O)C2)c(Cl)c1 |
| InChI | InChI=1S/C11H14ClN3O2/c12-7-3-6(11(13)14)1-2-8(7)15-4-9(16)10(17)5-15/h1-3,9-10,16-17H,4-5H2,(H3,13,14) |
| InChIKey | JJPVQTKDIWEEFA-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.71 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|