C10H21N3O4S — CID 106670197
1-(2-piperazin-1-ylethylsulfonyl)pyrrolidine-3,4-diol (PubChem CID 106670197) has the molecular formula C10H21N3O4S and a molecular weight of 279.36 g/mol. Its IUPAC name is 1-(2-piperazin-1-ylethylsulfonyl)pyrrolidine-3,4-diol.
| Compound Name | 1-(2-piperazin-1-ylethylsulfonyl)pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 106670197 |
| Molecular Formula | C10H21N3O4S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 1-(2-piperazin-1-ylethylsulfonyl)pyrrolidine-3,4-diol |
| SMILES | O=S(=O)(CCN1CCNCC1)N1CC(O)C(O)C1 |
| InChI | InChI=1S/C10H21N3O4S/c14-9-7-13(8-10(9)15)18(16,17)6-5-12-3-1-11-2-4-12/h9-11,14-15H,1-8H2 |
| InChIKey | ZCHJRRODXZUUSU-UHFFFAOYSA-N |
| XLogP | -2.74 |
| TPSA | 93.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | -2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |