About 1-(3,3-diethoxypropyl)pyrrolidine-3,4-diol
1-(3,3-diethoxypropyl)pyrrolidine-3,4-diol (PubChem CID 106670331) has the molecular formula C11H23NO4
and a molecular weight of 233.31 g/mol. Its IUPAC name is 1-(3,3-diethoxypropyl)pyrrolidine-3,4-diol.
Molecular Properties
| Compound Name | 1-(3,3-diethoxypropyl)pyrrolidine-3,4-diol |
| PubChem CID | 106670331 |
| Molecular Formula | C11H23NO4 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | 1-(3,3-diethoxypropyl)pyrrolidine-3,4-diol |
| SMILES | CCOC(CCN1CC(O)C(O)C1)OCC |
| InChI | InChI=1S/C11H23NO4/c1-3-15-11(16-4-2)5-6-12-7-9(13)10(14)8-12/h9-11,13-14H,3-8H2,1-2H3 |
| InChIKey | INFASMPDAGWDCP-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,3-diethoxypropyl)pyrrolidine-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,3-diethoxypropyl)pyrrolidine-3,4-diol?
The IUPAC name of 1-(3,3-diethoxypropyl)pyrrolidine-3,4-diol (CID 106670331) is 1-(3,3-diethoxypropyl)pyrrolidine-3,4-diol.
What is the SMILES notation for 1-(3,3-diethoxypropyl)pyrrolidine-3,4-diol?
The canonical SMILES for 1-(3,3-diethoxypropyl)pyrrolidine-3,4-diol is CCOC(CCN1CC(O)C(O)C1)OCC.
What is the InChIKey of 1-(3,3-diethoxypropyl)pyrrolidine-3,4-diol?
The InChIKey is INFASMPDAGWDCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO4/c1-3-15-11(16-4-2)5-6-12-7-9(13)10(14)8-12/h9-11,13-14H,3-8H2,1-2H3.
What are the key properties of 1-(3,3-diethoxypropyl)pyrrolidine-3,4-diol?
1-(3,3-diethoxypropyl)pyrrolidine-3,4-diol has a molecular weight of 233.31 g/mol, XLogP of -0.19, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,3-diethoxypropyl)pyrrolidine-3,4-diol is sourced from PubChem (CID 106670331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).