C12H14ClNO3 — CID 106670373
1-(2-chlorophenyl)-2-(3,4-dihydroxypyrrolidin-1-yl)ethanone (PubChem CID 106670373) has the molecular formula C12H14ClNO3 and a molecular weight of 255.70 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-2-(3,4-dihydroxypyrrolidin-1-yl)ethanone.
| Compound Name | 1-(2-chlorophenyl)-2-(3,4-dihydroxypyrrolidin-1-yl)ethanone |
|---|---|
| PubChem CID | 106670373 |
| Molecular Formula | C12H14ClNO3 |
| Molecular Weight | 255.70 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 1-(2-chlorophenyl)-2-(3,4-dihydroxypyrrolidin-1-yl)ethanone |
| SMILES | O=C(CN1CC(O)C(O)C1)c1ccccc1Cl |
| InChI | InChI=1S/C12H14ClNO3/c13-9-4-2-1-3-8(9)10(15)5-14-6-11(16)12(17)7-14/h1-4,11-12,16-17H,5-7H2 |
| InChIKey | NJSDSVFHRDZUIW-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.70 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |