About 5-[(3,4-dihydroxypyrrolidine-1-carbonyl)amino]-4-methylpentanoic acid
5-[(3,4-dihydroxypyrrolidine-1-carbonyl)amino]-4-methylpentanoic acid (PubChem CID 106670569) has the molecular formula C11H20N2O5
and a molecular weight of 260.29 g/mol. Its IUPAC name is 5-[(3,4-dihydroxypyrrolidine-1-carbonyl)amino]-4-methylpentanoic acid.
Molecular Properties
| Compound Name | 5-[(3,4-dihydroxypyrrolidine-1-carbonyl)amino]-4-methylpentanoic acid |
| PubChem CID | 106670569 |
| Molecular Formula | C11H20N2O5 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 5-[(3,4-dihydroxypyrrolidine-1-carbonyl)amino]-4-methylpentanoic acid |
| SMILES | CC(CCC(=O)O)CNC(=O)N1CC(O)C(O)C1 |
| InChI | InChI=1S/C11H20N2O5/c1-7(2-3-10(16)17)4-12-11(18)13-5-8(14)9(15)6-13/h7-9,14-15H,2-6H2,1H3,(H,12,18)(H,16,17) |
| InChIKey | NAJJMGWGEGSNMQ-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[(3,4-dihydroxypyrrolidine-1-carbonyl)amino]-4-methylpentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3,4-dihydroxypyrrolidine-1-carbonyl)amino]-4-methylpentanoic acid?
The IUPAC name of 5-[(3,4-dihydroxypyrrolidine-1-carbonyl)amino]-4-methylpentanoic acid (CID 106670569) is 5-[(3,4-dihydroxypyrrolidine-1-carbonyl)amino]-4-methylpentanoic acid.
What is the SMILES notation for 5-[(3,4-dihydroxypyrrolidine-1-carbonyl)amino]-4-methylpentanoic acid?
The canonical SMILES for 5-[(3,4-dihydroxypyrrolidine-1-carbonyl)amino]-4-methylpentanoic acid is CC(CCC(=O)O)CNC(=O)N1CC(O)C(O)C1.
What is the InChIKey of 5-[(3,4-dihydroxypyrrolidine-1-carbonyl)amino]-4-methylpentanoic acid?
The InChIKey is NAJJMGWGEGSNMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O5/c1-7(2-3-10(16)17)4-12-11(18)13-5-8(14)9(15)6-13/h7-9,14-15H,2-6H2,1H3,(H,12,18)(H,16,17).
What are the key properties of 5-[(3,4-dihydroxypyrrolidine-1-carbonyl)amino]-4-methylpentanoic acid?
5-[(3,4-dihydroxypyrrolidine-1-carbonyl)amino]-4-methylpentanoic acid has a molecular weight of 260.29 g/mol, XLogP of -0.77, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3,4-dihydroxypyrrolidine-1-carbonyl)amino]-4-methylpentanoic acid is sourced from PubChem (CID 106670569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).