C9H11ClN2O2 — CID 106670872
1-(2-chloro-4-pyridinyl)pyrrolidine-3,4-diol (PubChem CID 106670872) has the molecular formula C9H11ClN2O2 and a molecular weight of 214.65 g/mol. Its IUPAC name is 1-(2-chloro-4-pyridinyl)pyrrolidine-3,4-diol.
| Compound Name | 1-(2-chloro-4-pyridinyl)pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 106670872 |
| Molecular Formula | C9H11ClN2O2 |
| Molecular Weight | 214.65 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | 1-(2-chloro-4-pyridinyl)pyrrolidine-3,4-diol |
| SMILES | OC1CN(c2ccnc(Cl)c2)CC1O |
| InChI | InChI=1S/C9H11ClN2O2/c10-9-3-6(1-2-11-9)12-4-7(13)8(14)5-12/h1-3,7-8,13-14H,4-5H2 |
| InChIKey | VHSRPVOWAKVRBA-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 56.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.65 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|