About 1-(5-bromo-1,3,4-thiadiazol-2-yl)pyrrolidine-3,4-diol
1-(5-bromo-1,3,4-thiadiazol-2-yl)pyrrolidine-3,4-diol (PubChem CID 106670876) has the molecular formula C6H8BrN3O2S
and a molecular weight of 266.12 g/mol. Its IUPAC name is 1-(5-bromo-1,3,4-thiadiazol-2-yl)pyrrolidine-3,4-diol.
Molecular Properties
| Compound Name | 1-(5-bromo-1,3,4-thiadiazol-2-yl)pyrrolidine-3,4-diol |
| PubChem CID | 106670876 |
| Molecular Formula | C6H8BrN3O2S |
| Molecular Weight | 266.12 g/mol |
| Exact Mass | 264.95 |
| IUPAC Name | 1-(5-bromo-1,3,4-thiadiazol-2-yl)pyrrolidine-3,4-diol |
| SMILES | OC1CN(c2nnc(Br)s2)CC1O |
| InChI | InChI=1S/C6H8BrN3O2S/c7-5-8-9-6(13-5)10-1-3(11)4(12)2-10/h3-4,11-12H,1-2H2 |
| InChIKey | IHJUQGSEJYMUAP-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 69.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.12 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(5-bromo-1,3,4-thiadiazol-2-yl)pyrrolidine-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-bromo-1,3,4-thiadiazol-2-yl)pyrrolidine-3,4-diol?
The IUPAC name of 1-(5-bromo-1,3,4-thiadiazol-2-yl)pyrrolidine-3,4-diol (CID 106670876) is 1-(5-bromo-1,3,4-thiadiazol-2-yl)pyrrolidine-3,4-diol.
What is the SMILES notation for 1-(5-bromo-1,3,4-thiadiazol-2-yl)pyrrolidine-3,4-diol?
The canonical SMILES for 1-(5-bromo-1,3,4-thiadiazol-2-yl)pyrrolidine-3,4-diol is OC1CN(c2nnc(Br)s2)CC1O.
What is the InChIKey of 1-(5-bromo-1,3,4-thiadiazol-2-yl)pyrrolidine-3,4-diol?
The InChIKey is IHJUQGSEJYMUAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8BrN3O2S/c7-5-8-9-6(13-5)10-1-3(11)4(12)2-10/h3-4,11-12H,1-2H2.
What are the key properties of 1-(5-bromo-1,3,4-thiadiazol-2-yl)pyrrolidine-3,4-diol?
1-(5-bromo-1,3,4-thiadiazol-2-yl)pyrrolidine-3,4-diol has a molecular weight of 266.12 g/mol, XLogP of -0.16, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-bromo-1,3,4-thiadiazol-2-yl)pyrrolidine-3,4-diol is sourced from PubChem (CID 106670876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).