C23H38O2Si — CID 10667160
[(3S,4S,5R)-3,5-dimethyl-8-phenylmethoxyoct-1-yn-4-yl]oxy-triethylsilane (PubChem CID 10667160) has the molecular formula C23H38O2Si and a molecular weight of 374.64 g/mol. Its IUPAC name is [(3S,4S,5R)-3,5-dimethyl-8-phenylmethoxyoct-1-yn-4-yl]oxy-triethylsilane.
| Compound Name | [(3S,4S,5R)-3,5-dimethyl-8-phenylmethoxyoct-1-yn-4-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 10667160 |
| Molecular Formula | C23H38O2Si |
| Molecular Weight | 374.64 g/mol |
| Exact Mass | 374.26 |
| IUPAC Name | [(3S,4S,5R)-3,5-dimethyl-8-phenylmethoxyoct-1-yn-4-yl]oxy-triethylsilane |
| SMILES | C#C[C@H](C)[C@@H](O[Si](CC)(CC)CC)[C@H](C)CCCOCc1ccccc1 |
| InChI | InChI=1S/C23H38O2Si/c1-7-20(5)23(25-26(8-2,9-3)10-4)21(6)15-14-18-24-19-22-16-12-11-13-17-22/h1,11-13,16-17,20-21,23H,8-10,14-15,18-19H2,2-6H3/t20-,21+,23+/m0/s1 |
| InChIKey | DXZPQDPAUIHDQW-QZNHQXDQSA-N |
| XLogP | 6.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.64 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|