About 1-(2,2-difluoroethyl)pyrrolidine-3,4-diol
1-(2,2-difluoroethyl)pyrrolidine-3,4-diol (PubChem CID 106672206) has the molecular formula C6H11F2NO2
and a molecular weight of 167.15 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)pyrrolidine-3,4-diol.
Molecular Properties
| Compound Name | 1-(2,2-difluoroethyl)pyrrolidine-3,4-diol |
| PubChem CID | 106672206 |
| Molecular Formula | C6H11F2NO2 |
| Molecular Weight | 167.15 g/mol |
| Exact Mass | 167.08 |
| IUPAC Name | 1-(2,2-difluoroethyl)pyrrolidine-3,4-diol |
| SMILES | OC1CN(CC(F)F)CC1O |
| InChI | InChI=1S/C6H11F2NO2/c7-6(8)3-9-1-4(10)5(11)2-9/h4-6,10-11H,1-3H2 |
| InChIKey | VCHJFTHAYVVEPI-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.15 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(2,2-difluoroethyl)pyrrolidine-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-difluoroethyl)pyrrolidine-3,4-diol?
The IUPAC name of 1-(2,2-difluoroethyl)pyrrolidine-3,4-diol (CID 106672206) is 1-(2,2-difluoroethyl)pyrrolidine-3,4-diol.
What is the SMILES notation for 1-(2,2-difluoroethyl)pyrrolidine-3,4-diol?
The canonical SMILES for 1-(2,2-difluoroethyl)pyrrolidine-3,4-diol is OC1CN(CC(F)F)CC1O.
What is the InChIKey of 1-(2,2-difluoroethyl)pyrrolidine-3,4-diol?
The InChIKey is VCHJFTHAYVVEPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11F2NO2/c7-6(8)3-9-1-4(10)5(11)2-9/h4-6,10-11H,1-3H2.
What are the key properties of 1-(2,2-difluoroethyl)pyrrolidine-3,4-diol?
1-(2,2-difluoroethyl)pyrrolidine-3,4-diol has a molecular weight of 167.15 g/mol, XLogP of -0.71, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-difluoroethyl)pyrrolidine-3,4-diol is sourced from PubChem (CID 106672206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).