C23H20O5 — CID 10667235
5-methoxy-2-[2-methoxy-4-methyl-6-[(E)-3-oxobut-1-enyl]phenyl]naphthalene-1,4-dione (PubChem CID 10667235) has the molecular formula C23H20O5 and a molecular weight of 376.41 g/mol. Its IUPAC name is 5-methoxy-2-[2-methoxy-4-methyl-6-[(E)-3-oxobut-1-enyl]phenyl]naphthalene-1,4-dione.
| Compound Name | 5-methoxy-2-[2-methoxy-4-methyl-6-[(E)-3-oxobut-1-enyl]phenyl]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 10667235 |
| Molecular Formula | C23H20O5 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | 5-methoxy-2-[2-methoxy-4-methyl-6-[(E)-3-oxobut-1-enyl]phenyl]naphthalene-1,4-dione |
| SMILES | COc1cc(C)cc(/C=C/C(C)=O)c1C1=CC(=O)c2c(OC)cccc2C1=O |
| InChI | InChI=1S/C23H20O5/c1-13-10-15(9-8-14(2)24)21(20(11-13)28-4)17-12-18(25)22-16(23(17)26)6-5-7-19(22)27-3/h5-12H,1-4H3/b9-8+ |
| InChIKey | RZGYKZZEIZVYSW-CMDGGOBGSA-N |
| XLogP | 4.08 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|