C11H14FN3O3 — CID 106673186
2-amino-5-(3,4-dihydroxypyrrolidin-1-yl)-4-fluorobenzamide (PubChem CID 106673186) has the molecular formula C11H14FN3O3 and a molecular weight of 255.25 g/mol. Its IUPAC name is 2-amino-5-(3,4-dihydroxypyrrolidin-1-yl)-4-fluorobenzamide.
| Compound Name | 2-amino-5-(3,4-dihydroxypyrrolidin-1-yl)-4-fluorobenzamide |
|---|---|
| PubChem CID | 106673186 |
| Molecular Formula | C11H14FN3O3 |
| Molecular Weight | 255.25 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 2-amino-5-(3,4-dihydroxypyrrolidin-1-yl)-4-fluorobenzamide |
| SMILES | NC(=O)c1cc(N2CC(O)C(O)C2)c(F)cc1N |
| InChI | InChI=1S/C11H14FN3O3/c12-6-2-7(13)5(11(14)18)1-8(6)15-3-9(16)10(17)4-15/h1-2,9-10,16-17H,3-4,13H2,(H2,14,18) |
| InChIKey | YWUCCJUGLUVXAI-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.25 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|