C14H16N2O3 — CID 106673213
1-(6-methoxyisoquinolin-1-yl)pyrrolidine-3,4-diol (PubChem CID 106673213) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is 1-(6-methoxyisoquinolin-1-yl)pyrrolidine-3,4-diol.
| Compound Name | 1-(6-methoxyisoquinolin-1-yl)pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 106673213 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 1-(6-methoxyisoquinolin-1-yl)pyrrolidine-3,4-diol |
| SMILES | COc1ccc2c(N3CC(O)C(O)C3)nccc2c1 |
| InChI | InChI=1S/C14H16N2O3/c1-19-10-2-3-11-9(6-10)4-5-15-14(11)16-7-12(17)13(18)8-16/h2-6,12-13,17-18H,7-8H2,1H3 |
| InChIKey | XMOGOYRYLLYBPA-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 65.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |