C13H13ClN2O2 — CID 106673359
1-(7-chloroquinolin-4-yl)pyrrolidine-3,4-diol (PubChem CID 106673359) has the molecular formula C13H13ClN2O2 and a molecular weight of 264.71 g/mol. Its IUPAC name is 1-(7-chloroquinolin-4-yl)pyrrolidine-3,4-diol.
| Compound Name | 1-(7-chloroquinolin-4-yl)pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 106673359 |
| Molecular Formula | C13H13ClN2O2 |
| Molecular Weight | 264.71 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 1-(7-chloroquinolin-4-yl)pyrrolidine-3,4-diol |
| SMILES | OC1CN(c2ccnc3cc(Cl)ccc23)CC1O |
| InChI | InChI=1S/C13H13ClN2O2/c14-8-1-2-9-10(5-8)15-4-3-11(9)16-6-12(17)13(18)7-16/h1-5,12-13,17-18H,6-7H2 |
| InChIKey | REDXBFLFBHWKSD-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 56.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.71 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |