C15H17NO5 — CID 106673590
(E)-3-[3-(3,4-dihydroxypyrrolidine-1-carbonyl)-4-methylphenyl]prop-2-enoic acid (PubChem CID 106673590) has the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. Its IUPAC name is (E)-3-[3-(3,4-dihydroxypyrrolidine-1-carbonyl)-4-methylphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-(3,4-dihydroxypyrrolidine-1-carbonyl)-4-methylphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 106673590 |
| Molecular Formula | C15H17NO5 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | (E)-3-[3-(3,4-dihydroxypyrrolidine-1-carbonyl)-4-methylphenyl]prop-2-enoic acid |
| SMILES | Cc1ccc(/C=C/C(=O)O)cc1C(=O)N1CC(O)C(O)C1 |
| InChI | InChI=1S/C15H17NO5/c1-9-2-3-10(4-5-14(19)20)6-11(9)15(21)16-7-12(17)13(18)8-16/h2-6,12-13,17-18H,7-8H2,1H3,(H,19,20)/b5-4+ |
| InChIKey | FIPBMWJXCZQCQY-SNAWJCMRSA-N |
| XLogP | 0.27 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|