About 1-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]pyrrolidine-3,4-diol
1-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]pyrrolidine-3,4-diol (PubChem CID 106673960) has the molecular formula C8H14N4O2S
and a molecular weight of 230.29 g/mol. Its IUPAC name is 1-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]pyrrolidine-3,4-diol.
Molecular Properties
| Compound Name | 1-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]pyrrolidine-3,4-diol |
| PubChem CID | 106673960 |
| Molecular Formula | C8H14N4O2S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 1-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]pyrrolidine-3,4-diol |
| SMILES | NNc1ncc(CN2CC(O)C(O)C2)s1 |
| InChI | InChI=1S/C8H14N4O2S/c9-11-8-10-1-5(15-8)2-12-3-6(13)7(14)4-12/h1,6-7,13-14H,2-4,9H2,(H,10,11) |
| InChIKey | HCZNKCNRRVRFKZ-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]pyrrolidine-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]pyrrolidine-3,4-diol?
The IUPAC name of 1-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]pyrrolidine-3,4-diol (CID 106673960) is 1-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]pyrrolidine-3,4-diol.
What is the SMILES notation for 1-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]pyrrolidine-3,4-diol?
The canonical SMILES for 1-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]pyrrolidine-3,4-diol is NNc1ncc(CN2CC(O)C(O)C2)s1.
What is the InChIKey of 1-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]pyrrolidine-3,4-diol?
The InChIKey is HCZNKCNRRVRFKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4O2S/c9-11-8-10-1-5(15-8)2-12-3-6(13)7(14)4-12/h1,6-7,13-14H,2-4,9H2,(H,10,11).
What are the key properties of 1-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]pyrrolidine-3,4-diol?
1-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]pyrrolidine-3,4-diol has a molecular weight of 230.29 g/mol, XLogP of -1.03, 3 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-hydrazinyl-1,3-thiazol-5-yl)methyl]pyrrolidine-3,4-diol is sourced from PubChem (CID 106673960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).