C10H19NO4 — CID 106674242
1-[(4-hydroxyoxan-3-yl)methyl]pyrrolidine-3,4-diol (PubChem CID 106674242) has the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. Its IUPAC name is 1-[(4-hydroxyoxan-3-yl)methyl]pyrrolidine-3,4-diol.
| Compound Name | 1-[(4-hydroxyoxan-3-yl)methyl]pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 106674242 |
| Molecular Formula | C10H19NO4 |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 1-[(4-hydroxyoxan-3-yl)methyl]pyrrolidine-3,4-diol |
| SMILES | OC1CN(CC2COCCC2O)CC1O |
| InChI | InChI=1S/C10H19NO4/c12-8-1-2-15-6-7(8)3-11-4-9(13)10(14)5-11/h7-10,12-14H,1-6H2 |
| InChIKey | HSCUPFLGFKQJHI-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |