C8H17N3O3 — CID 106674306
4-(3,4-dihydroxypyrrolidin-1-yl)butanehydrazide (PubChem CID 106674306) has the molecular formula C8H17N3O3 and a molecular weight of 203.24 g/mol. Its IUPAC name is 4-(3,4-dihydroxypyrrolidin-1-yl)butanehydrazide.
| Compound Name | 4-(3,4-dihydroxypyrrolidin-1-yl)butanehydrazide |
|---|---|
| PubChem CID | 106674306 |
| Molecular Formula | C8H17N3O3 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 4-(3,4-dihydroxypyrrolidin-1-yl)butanehydrazide |
| SMILES | NNC(=O)CCCN1CC(O)C(O)C1 |
| InChI | InChI=1S/C8H17N3O3/c9-10-8(14)2-1-3-11-4-6(12)7(13)5-11/h6-7,12-13H,1-5,9H2,(H,10,14) |
| InChIKey | GLPRJNDABLDXQJ-UHFFFAOYSA-N |
| XLogP | -2.21 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|