C10H16N4O2 — CID 106674481
1-[6-methyl-2-(methylamino)pyrimidin-4-yl]pyrrolidine-3,4-diol (PubChem CID 106674481) has the molecular formula C10H16N4O2 and a molecular weight of 224.26 g/mol. Its IUPAC name is 1-[6-methyl-2-(methylamino)pyrimidin-4-yl]pyrrolidine-3,4-diol.
| Compound Name | 1-[6-methyl-2-(methylamino)pyrimidin-4-yl]pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 106674481 |
| Molecular Formula | C10H16N4O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 1-[6-methyl-2-(methylamino)pyrimidin-4-yl]pyrrolidine-3,4-diol |
| SMILES | CNc1nc(C)cc(N2CC(O)C(O)C2)n1 |
| InChI | InChI=1S/C10H16N4O2/c1-6-3-9(13-10(11-2)12-6)14-4-7(15)8(16)5-14/h3,7-8,15-16H,4-5H2,1-2H3,(H,11,12,13) |
| InChIKey | WRWFYUVADHXCHR-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |