C13H22N4O2 — CID 106674538
1-[6-(ethylamino)-5-propylpyrimidin-4-yl]pyrrolidine-3,4-diol (PubChem CID 106674538) has the molecular formula C13H22N4O2 and a molecular weight of 266.34 g/mol. Its IUPAC name is 1-[6-(ethylamino)-5-propylpyrimidin-4-yl]pyrrolidine-3,4-diol.
| Compound Name | 1-[6-(ethylamino)-5-propylpyrimidin-4-yl]pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 106674538 |
| Molecular Formula | C13H22N4O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 1-[6-(ethylamino)-5-propylpyrimidin-4-yl]pyrrolidine-3,4-diol |
| SMILES | CCCc1c(NCC)ncnc1N1CC(O)C(O)C1 |
| InChI | InChI=1S/C13H22N4O2/c1-3-5-9-12(14-4-2)15-8-16-13(9)17-6-10(18)11(19)7-17/h8,10-11,18-19H,3-7H2,1-2H3,(H,14,15,16) |
| InChIKey | OCAHYXBYLAPYMQ-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |