C16H21BrN2O2 — CID 106674831
5-bromo-2-[3-(tert-butylamino)-2-methylpropyl]isoindole-1,3-dione (PubChem CID 106674831) has the molecular formula C16H21BrN2O2 and a molecular weight of 353.26 g/mol. Its IUPAC name is 5-bromo-2-[3-(tert-butylamino)-2-methylpropyl]isoindole-1,3-dione.
| Compound Name | 5-bromo-2-[3-(tert-butylamino)-2-methylpropyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 106674831 |
| Molecular Formula | C16H21BrN2O2 |
| Molecular Weight | 353.26 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | 5-bromo-2-[3-(tert-butylamino)-2-methylpropyl]isoindole-1,3-dione |
| SMILES | CC(CNC(C)(C)C)CN1C(=O)c2ccc(Br)cc2C1=O |
| InChI | InChI=1S/C16H21BrN2O2/c1-10(8-18-16(2,3)4)9-19-14(20)12-6-5-11(17)7-13(12)15(19)21/h5-7,10,18H,8-9H2,1-4H3 |
| InChIKey | QGUQPRFCFOLEQS-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.26 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|