C18H29NO4SSi — CID 10667696
ethyl (2S)-4-phenyl-2-(2-trimethylsilylethylsulfonylamino)pent-4-enoate (PubChem CID 10667696) has the molecular formula C18H29NO4SSi and a molecular weight of 383.59 g/mol. Its IUPAC name is ethyl (2S)-4-phenyl-2-(2-trimethylsilylethylsulfonylamino)pent-4-enoate.
| Compound Name | ethyl (2S)-4-phenyl-2-(2-trimethylsilylethylsulfonylamino)pent-4-enoate |
|---|---|
| PubChem CID | 10667696 |
| Molecular Formula | C18H29NO4SSi |
| Molecular Weight | 383.59 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | ethyl (2S)-4-phenyl-2-(2-trimethylsilylethylsulfonylamino)pent-4-enoate |
| SMILES | C=C(C[C@H](NS(=O)(=O)CC[Si](C)(C)C)C(=O)OCC)c1ccccc1 |
| InChI | InChI=1S/C18H29NO4SSi/c1-6-23-18(20)17(14-15(2)16-10-8-7-9-11-16)19-24(21,22)12-13-25(3,4)5/h7-11,17,19H,2,6,12-14H2,1,3-5H3/t17-/m0/s1 |
| InChIKey | CNPXZIZGKUWVAC-KRWDZBQOSA-N |
| XLogP | 3.28 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.59 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|