C12H16O3 — CID 106677432
5-hydroxy-1-(3-methoxyphenyl)pentan-2-one (PubChem CID 106677432) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is 5-hydroxy-1-(3-methoxyphenyl)pentan-2-one.
| Compound Name | 5-hydroxy-1-(3-methoxyphenyl)pentan-2-one |
|---|---|
| PubChem CID | 106677432 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 5-hydroxy-1-(3-methoxyphenyl)pentan-2-one |
| SMILES | COc1cccc(CC(=O)CCCO)c1 |
| InChI | InChI=1S/C12H16O3/c1-15-12-6-2-4-10(9-12)8-11(14)5-3-7-13/h2,4,6,9,13H,3,5,7-8H2,1H3 |
| InChIKey | SNSZQPDPCXPNTB-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |