C12H15FO2 — CID 106677668
1-(5-fluoro-2-methylphenyl)-5-hydroxypentan-2-one (PubChem CID 106677668) has the molecular formula C12H15FO2 and a molecular weight of 210.25 g/mol. Its IUPAC name is 1-(5-fluoro-2-methylphenyl)-5-hydroxypentan-2-one.
| Compound Name | 1-(5-fluoro-2-methylphenyl)-5-hydroxypentan-2-one |
|---|---|
| PubChem CID | 106677668 |
| Molecular Formula | C12H15FO2 |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 1-(5-fluoro-2-methylphenyl)-5-hydroxypentan-2-one |
| SMILES | Cc1ccc(F)cc1CC(=O)CCCO |
| InChI | InChI=1S/C12H15FO2/c1-9-4-5-11(13)7-10(9)8-12(15)3-2-6-14/h4-5,7,14H,2-3,6,8H2,1H3 |
| InChIKey | KVHURKLBDAFIQI-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |