C10H18N2O2 — CID 106677975
6-(2-methylpyrazol-3-yl)hexane-1,4-diol (PubChem CID 106677975) has the molecular formula C10H18N2O2 and a molecular weight of 198.27 g/mol. Its IUPAC name is 6-(2-methylpyrazol-3-yl)hexane-1,4-diol.
| Compound Name | 6-(2-methylpyrazol-3-yl)hexane-1,4-diol |
|---|---|
| PubChem CID | 106677975 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 6-(2-methylpyrazol-3-yl)hexane-1,4-diol |
| SMILES | Cn1nccc1CCC(O)CCCO |
| InChI | InChI=1S/C10H18N2O2/c1-12-9(6-7-11-12)4-5-10(14)3-2-8-13/h6-7,10,13-14H,2-5,8H2,1H3 |
| InChIKey | YOAOCQOWHJWXIT-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |