About 3-(2,2-difluoroethylsulfanyl)pyrazin-2-amine
3-(2,2-difluoroethylsulfanyl)pyrazin-2-amine (PubChem CID 106678507) has the molecular formula C6H7F2N3S
and a molecular weight of 191.21 g/mol. Its IUPAC name is 3-(2,2-difluoroethylsulfanyl)pyrazin-2-amine.
Molecular Properties
| Compound Name | 3-(2,2-difluoroethylsulfanyl)pyrazin-2-amine |
| PubChem CID | 106678507 |
| Molecular Formula | C6H7F2N3S |
| Molecular Weight | 191.21 g/mol |
| Exact Mass | 191.03 |
| IUPAC Name | 3-(2,2-difluoroethylsulfanyl)pyrazin-2-amine |
| SMILES | Nc1nccnc1SCC(F)F |
| InChI | InChI=1S/C6H7F2N3S/c7-4(8)3-12-6-5(9)10-1-2-11-6/h1-2,4H,3H2,(H2,9,10) |
| InChIKey | DIBDXMQJUDLZIO-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.21 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(2,2-difluoroethylsulfanyl)pyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,2-difluoroethylsulfanyl)pyrazin-2-amine?
The IUPAC name of 3-(2,2-difluoroethylsulfanyl)pyrazin-2-amine (CID 106678507) is 3-(2,2-difluoroethylsulfanyl)pyrazin-2-amine.
What is the SMILES notation for 3-(2,2-difluoroethylsulfanyl)pyrazin-2-amine?
The canonical SMILES for 3-(2,2-difluoroethylsulfanyl)pyrazin-2-amine is Nc1nccnc1SCC(F)F.
What is the InChIKey of 3-(2,2-difluoroethylsulfanyl)pyrazin-2-amine?
The InChIKey is DIBDXMQJUDLZIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7F2N3S/c7-4(8)3-12-6-5(9)10-1-2-11-6/h1-2,4H,3H2,(H2,9,10).
What are the key properties of 3-(2,2-difluoroethylsulfanyl)pyrazin-2-amine?
3-(2,2-difluoroethylsulfanyl)pyrazin-2-amine has a molecular weight of 191.21 g/mol, XLogP of 1.42, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,2-difluoroethylsulfanyl)pyrazin-2-amine is sourced from PubChem (CID 106678507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).