About N-(4-chlorophenyl)-N,3-dimethyl-4-phenylquinoline-2-carboxamide
N-(4-chlorophenyl)-N,3-dimethyl-4-phenylquinoline-2-carboxamide (PubChem CID 10667910) has the molecular formula C24H19ClN2O
and a molecular weight of 386.88 g/mol. Its IUPAC name is N-(4-chlorophenyl)-N,3-dimethyl-4-phenylquinoline-2-carboxamide.
Molecular Properties
| Compound Name | N-(4-chlorophenyl)-N,3-dimethyl-4-phenylquinoline-2-carboxamide |
| PubChem CID | 10667910 |
| Molecular Formula | C24H19ClN2O |
| Molecular Weight | 386.88 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | N-(4-chlorophenyl)-N,3-dimethyl-4-phenylquinoline-2-carboxamide |
| SMILES | Cc1c(C(=O)N(C)c2ccc(Cl)cc2)nc2ccccc2c1-c1ccccc1 |
| InChI | InChI=1S/C24H19ClN2O/c1-16-22(17-8-4-3-5-9-17)20-10-6-7-11-21(20)26-23(16)24(28)27(2)19-14-12-18(25)13-15-19/h3-15H,1-2H3 |
| InChIKey | VITHAIPHWHWXDX-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.88 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(4-chlorophenyl)-N,3-dimethyl-4-phenylquinoline-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-chlorophenyl)-N,3-dimethyl-4-phenylquinoline-2-carboxamide?
The IUPAC name of N-(4-chlorophenyl)-N,3-dimethyl-4-phenylquinoline-2-carboxamide (CID 10667910) is N-(4-chlorophenyl)-N,3-dimethyl-4-phenylquinoline-2-carboxamide.
What is the SMILES notation for N-(4-chlorophenyl)-N,3-dimethyl-4-phenylquinoline-2-carboxamide?
The canonical SMILES for N-(4-chlorophenyl)-N,3-dimethyl-4-phenylquinoline-2-carboxamide is Cc1c(C(=O)N(C)c2ccc(Cl)cc2)nc2ccccc2c1-c1ccccc1.
What is the InChIKey of N-(4-chlorophenyl)-N,3-dimethyl-4-phenylquinoline-2-carboxamide?
The InChIKey is VITHAIPHWHWXDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H19ClN2O/c1-16-22(17-8-4-3-5-9-17)20-10-6-7-11-21(20)26-23(16)24(28)27(2)19-14-12-18(25)13-15-19/h3-15H,1-2H3.
What are the key properties of N-(4-chlorophenyl)-N,3-dimethyl-4-phenylquinoline-2-carboxamide?
N-(4-chlorophenyl)-N,3-dimethyl-4-phenylquinoline-2-carboxamide has a molecular weight of 386.88 g/mol, XLogP of 6.14, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-chlorophenyl)-N,3-dimethyl-4-phenylquinoline-2-carboxamide is sourced from PubChem (CID 10667910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).