C12H10F3N3S — CID 106679214
3-[[2-(trifluoromethyl)phenyl]methylsulfanyl]pyrazin-2-amine (PubChem CID 106679214) has the molecular formula C12H10F3N3S and a molecular weight of 285.29 g/mol. Its IUPAC name is 3-[[2-(trifluoromethyl)phenyl]methylsulfanyl]pyrazin-2-amine.
| Compound Name | 3-[[2-(trifluoromethyl)phenyl]methylsulfanyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 106679214 |
| Molecular Formula | C12H10F3N3S |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | 3-[[2-(trifluoromethyl)phenyl]methylsulfanyl]pyrazin-2-amine |
| SMILES | Nc1nccnc1SCc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C12H10F3N3S/c13-12(14,15)9-4-2-1-3-8(9)7-19-11-10(16)17-5-6-18-11/h1-6H,7H2,(H2,16,17) |
| InChIKey | UNXGQDHHTHZWFK-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |