About 3-[(5-methyl-1,3-oxazol-4-yl)methylsulfanyl]pyrazin-2-amine
3-[(5-methyl-1,3-oxazol-4-yl)methylsulfanyl]pyrazin-2-amine (PubChem CID 106679346) has the molecular formula C9H10N4OS
and a molecular weight of 222.27 g/mol. Its IUPAC name is 3-[(5-methyl-1,3-oxazol-4-yl)methylsulfanyl]pyrazin-2-amine.
Molecular Properties
| Compound Name | 3-[(5-methyl-1,3-oxazol-4-yl)methylsulfanyl]pyrazin-2-amine |
| PubChem CID | 106679346 |
| Molecular Formula | C9H10N4OS |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 3-[(5-methyl-1,3-oxazol-4-yl)methylsulfanyl]pyrazin-2-amine |
| SMILES | Cc1ocnc1CSc1nccnc1N |
| InChI | InChI=1S/C9H10N4OS/c1-6-7(13-5-14-6)4-15-9-8(10)11-2-3-12-9/h2-3,5H,4H2,1H3,(H2,10,11) |
| InChIKey | OIJVGJZNTMJXNP-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[(5-methyl-1,3-oxazol-4-yl)methylsulfanyl]pyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5-methyl-1,3-oxazol-4-yl)methylsulfanyl]pyrazin-2-amine?
The IUPAC name of 3-[(5-methyl-1,3-oxazol-4-yl)methylsulfanyl]pyrazin-2-amine (CID 106679346) is 3-[(5-methyl-1,3-oxazol-4-yl)methylsulfanyl]pyrazin-2-amine.
What is the SMILES notation for 3-[(5-methyl-1,3-oxazol-4-yl)methylsulfanyl]pyrazin-2-amine?
The canonical SMILES for 3-[(5-methyl-1,3-oxazol-4-yl)methylsulfanyl]pyrazin-2-amine is Cc1ocnc1CSc1nccnc1N.
What is the InChIKey of 3-[(5-methyl-1,3-oxazol-4-yl)methylsulfanyl]pyrazin-2-amine?
The InChIKey is OIJVGJZNTMJXNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4OS/c1-6-7(13-5-14-6)4-15-9-8(10)11-2-3-12-9/h2-3,5H,4H2,1H3,(H2,10,11).
What are the key properties of 3-[(5-methyl-1,3-oxazol-4-yl)methylsulfanyl]pyrazin-2-amine?
3-[(5-methyl-1,3-oxazol-4-yl)methylsulfanyl]pyrazin-2-amine has a molecular weight of 222.27 g/mol, XLogP of 1.65, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5-methyl-1,3-oxazol-4-yl)methylsulfanyl]pyrazin-2-amine is sourced from PubChem (CID 106679346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).