C16H17BrO2 — CID 106679553
(3-bromophenyl)-(2-methoxy-4,6-dimethylphenyl)methanol (PubChem CID 106679553) has the molecular formula C16H17BrO2 and a molecular weight of 321.21 g/mol. Its IUPAC name is (3-bromophenyl)-(2-methoxy-4,6-dimethylphenyl)methanol.
| Compound Name | (3-bromophenyl)-(2-methoxy-4,6-dimethylphenyl)methanol |
|---|---|
| PubChem CID | 106679553 |
| Molecular Formula | C16H17BrO2 |
| Molecular Weight | 321.21 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | (3-bromophenyl)-(2-methoxy-4,6-dimethylphenyl)methanol |
| SMILES | COc1cc(C)cc(C)c1C(O)c1cccc(Br)c1 |
| InChI | InChI=1S/C16H17BrO2/c1-10-7-11(2)15(14(8-10)19-3)16(18)12-5-4-6-13(17)9-12/h4-9,16,18H,1-3H3 |
| InChIKey | KSDWHNPVGQDWPK-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.21 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |