C18H18O2S — CID 106679584
1-benzothiophen-3-yl-(2-methoxy-4,6-dimethylphenyl)methanol (PubChem CID 106679584) has the molecular formula C18H18O2S and a molecular weight of 298.41 g/mol. Its IUPAC name is 1-benzothiophen-3-yl-(2-methoxy-4,6-dimethylphenyl)methanol.
| Compound Name | 1-benzothiophen-3-yl-(2-methoxy-4,6-dimethylphenyl)methanol |
|---|---|
| PubChem CID | 106679584 |
| Molecular Formula | C18H18O2S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 1-benzothiophen-3-yl-(2-methoxy-4,6-dimethylphenyl)methanol |
| SMILES | COc1cc(C)cc(C)c1C(O)c1csc2ccccc12 |
| InChI | InChI=1S/C18H18O2S/c1-11-8-12(2)17(15(9-11)20-3)18(19)14-10-21-16-7-5-4-6-13(14)16/h4-10,18-19H,1-3H3 |
| InChIKey | MLWFOGIIJBBIFR-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |