C17H26O2 — CID 106679635
1-(2-methoxy-4,6-dimethylphenyl)-3,4-dimethylcyclohexan-1-ol (PubChem CID 106679635) has the molecular formula C17H26O2 and a molecular weight of 262.39 g/mol. Its IUPAC name is 1-(2-methoxy-4,6-dimethylphenyl)-3,4-dimethylcyclohexan-1-ol.
| Compound Name | 1-(2-methoxy-4,6-dimethylphenyl)-3,4-dimethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 106679635 |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | 1-(2-methoxy-4,6-dimethylphenyl)-3,4-dimethylcyclohexan-1-ol |
| SMILES | COc1cc(C)cc(C)c1C1(O)CCC(C)C(C)C1 |
| InChI | InChI=1S/C17H26O2/c1-11-8-13(3)16(15(9-11)19-5)17(18)7-6-12(2)14(4)10-17/h8-9,12,14,18H,6-7,10H2,1-5H3 |
| InChIKey | ISXPFXIMEMJKDT-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |