C13H21NO — CID 106680438
N-ethyl-1-(2-methoxy-4,6-dimethylphenyl)ethanamine (PubChem CID 106680438) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is N-ethyl-1-(2-methoxy-4,6-dimethylphenyl)ethanamine.
| Compound Name | N-ethyl-1-(2-methoxy-4,6-dimethylphenyl)ethanamine |
|---|---|
| PubChem CID | 106680438 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | N-ethyl-1-(2-methoxy-4,6-dimethylphenyl)ethanamine |
| SMILES | CCNC(C)c1c(C)cc(C)cc1OC |
| InChI | InChI=1S/C13H21NO/c1-6-14-11(4)13-10(3)7-9(2)8-12(13)15-5/h7-8,11,14H,6H2,1-5H3 |
| InChIKey | DUQUSQUGYXACSZ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |