C16H18ClNO — CID 106681165
[2-chloro-4-(2-methoxy-4,6-dimethylphenyl)phenyl]methanamine (PubChem CID 106681165) has the molecular formula C16H18ClNO and a molecular weight of 275.78 g/mol. Its IUPAC name is [2-chloro-4-(2-methoxy-4,6-dimethylphenyl)phenyl]methanamine.
| Compound Name | [2-chloro-4-(2-methoxy-4,6-dimethylphenyl)phenyl]methanamine |
|---|---|
| PubChem CID | 106681165 |
| Molecular Formula | C16H18ClNO |
| Molecular Weight | 275.78 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | [2-chloro-4-(2-methoxy-4,6-dimethylphenyl)phenyl]methanamine |
| SMILES | COc1cc(C)cc(C)c1-c1ccc(CN)c(Cl)c1 |
| InChI | InChI=1S/C16H18ClNO/c1-10-6-11(2)16(15(7-10)19-3)12-4-5-13(9-18)14(17)8-12/h4-8H,9,18H2,1-3H3 |
| InChIKey | QHMWAHKETZKQHN-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.78 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |