C25H30N2O2 — CID 10668146
ethyl 4-[3-(butan-2-ylamino)propyl]-1-phenylisoquinoline-3-carboxylate (PubChem CID 10668146) has the molecular formula C25H30N2O2 and a molecular weight of 390.53 g/mol. Its IUPAC name is ethyl 4-[3-(butan-2-ylamino)propyl]-1-phenylisoquinoline-3-carboxylate.
| Compound Name | ethyl 4-[3-(butan-2-ylamino)propyl]-1-phenylisoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 10668146 |
| Molecular Formula | C25H30N2O2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | ethyl 4-[3-(butan-2-ylamino)propyl]-1-phenylisoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1nc(-c2ccccc2)c2ccccc2c1CCCNC(C)CC |
| InChI | InChI=1S/C25H30N2O2/c1-4-18(3)26-17-11-16-22-20-14-9-10-15-21(20)23(19-12-7-6-8-13-19)27-24(22)25(28)29-5-2/h6-10,12-15,18,26H,4-5,11,16-17H2,1-3H3 |
| InChIKey | NYJKABPPQARLEN-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|