C21H32O3SSi — CID 10668258
(4aR,9aS)-2,2-ditert-butyl-6-phenylsulfanyl-4a,6,7,9a-tetrahydro-4H-[1,3,2]dioxasilino[5,4-b]oxepine (PubChem CID 10668258) has the molecular formula C21H32O3SSi and a molecular weight of 392.64 g/mol. Its IUPAC name is (4aR,9aS)-2,2-ditert-butyl-6-phenylsulfanyl-4a,6,7,9a-tetrahydro-4H-[1,3,2]dioxasilino[5,4-b]oxepine.
| Compound Name | (4aR,9aS)-2,2-ditert-butyl-6-phenylsulfanyl-4a,6,7,9a-tetrahydro-4H-[1,3,2]dioxasilino[5,4-b]oxepine |
|---|---|
| PubChem CID | 10668258 |
| Molecular Formula | C21H32O3SSi |
| Molecular Weight | 392.64 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | (4aR,9aS)-2,2-ditert-butyl-6-phenylsulfanyl-4a,6,7,9a-tetrahydro-4H-[1,3,2]dioxasilino[5,4-b]oxepine |
| SMILES | CC(C)(C)[Si]1(C(C)(C)C)OC[C@H]2OC(Sc3ccccc3)CC=C[C@@H]2O1 |
| InChI | InChI=1S/C21H32O3SSi/c1-20(2,3)26(21(4,5)6)22-15-18-17(24-26)13-10-14-19(23-18)25-16-11-8-7-9-12-16/h7-13,17-19H,14-15H2,1-6H3/t17-,18+,19?/m0/s1 |
| InChIKey | VCNFFNCUUSHSLL-PAMZHZACSA-N |
| XLogP | 5.91 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.64 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|