About 3-(2-hydroxyphenyl)-2,4-dimethyl-5-phenyl-1H-pyrimidin-3-ium-6-one perchlorate
3-(2-hydroxyphenyl)-2,4-dimethyl-5-phenyl-1H-pyrimidin-3-ium-6-one perchlorate (PubChem CID 10668263) has the molecular formula C18H17ClN2O6
and a molecular weight of 392.80 g/mol. Its IUPAC name is 3-(2-hydroxyphenyl)-2,4-dimethyl-5-phenyl-1H-pyrimidin-3-ium-6-one perchlorate.
Molecular Properties
| Compound Name | 3-(2-hydroxyphenyl)-2,4-dimethyl-5-phenyl-1H-pyrimidin-3-ium-6-one perchlorate |
| PubChem CID | 10668263 |
| Molecular Formula | C18H17ClN2O6 |
| Molecular Weight | 392.80 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | 3-(2-hydroxyphenyl)-2,4-dimethyl-5-phenyl-1H-pyrimidin-3-ium-6-one perchlorate |
| SMILES | Cc1[nH]c(=O)c(-c2ccccc2)c(C)[n+]1-c1ccccc1O.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C18H16N2O2.ClHO4/c1-12-17(14-8-4-3-5-9-14)18(22)19-13(2)20(12)15-10-6-7-11-16(15)21;2-1(3,4)5/h3-11,21H,1-2H3;(H,2,3,4,5) |
| InChIKey | JZUSIRLWWUXUKU-UHFFFAOYSA-N |
| XLogP | -2.11 |
| TPSA | 149.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.80 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-hydroxyphenyl)-2,4-dimethyl-5-phenyl-1H-pyrimidin-3-ium-6-one perchlorate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-hydroxyphenyl)-2,4-dimethyl-5-phenyl-1H-pyrimidin-3-ium-6-one perchlorate?
The IUPAC name of 3-(2-hydroxyphenyl)-2,4-dimethyl-5-phenyl-1H-pyrimidin-3-ium-6-one perchlorate (CID 10668263) is 3-(2-hydroxyphenyl)-2,4-dimethyl-5-phenyl-1H-pyrimidin-3-ium-6-one perchlorate.
What is the SMILES notation for 3-(2-hydroxyphenyl)-2,4-dimethyl-5-phenyl-1H-pyrimidin-3-ium-6-one perchlorate?
The canonical SMILES for 3-(2-hydroxyphenyl)-2,4-dimethyl-5-phenyl-1H-pyrimidin-3-ium-6-one perchlorate is Cc1[nH]c(=O)c(-c2ccccc2)c(C)[n+]1-c1ccccc1O.[O-][Cl+3]([O-])([O-])[O-].
What is the InChIKey of 3-(2-hydroxyphenyl)-2,4-dimethyl-5-phenyl-1H-pyrimidin-3-ium-6-one perchlorate?
The InChIKey is JZUSIRLWWUXUKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N2O2.ClHO4/c1-12-17(14-8-4-3-5-9-14)18(22)19-13(2)20(12)15-10-6-7-11-16(15)21;2-1(3,4)5/h3-11,21H,1-2H3;(H,2,3,4,5).
What are the key properties of 3-(2-hydroxyphenyl)-2,4-dimethyl-5-phenyl-1H-pyrimidin-3-ium-6-one perchlorate?
3-(2-hydroxyphenyl)-2,4-dimethyl-5-phenyl-1H-pyrimidin-3-ium-6-one perchlorate has a molecular weight of 392.80 g/mol, XLogP of -2.11, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-hydroxyphenyl)-2,4-dimethyl-5-phenyl-1H-pyrimidin-3-ium-6-one perchlorate is sourced from PubChem (CID 10668263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).