C11H16F2N2O — CID 106682824
[2,2-difluoro-1-(2-methoxy-4,6-dimethylphenyl)ethyl]hydrazine (PubChem CID 106682824) has the molecular formula C11H16F2N2O and a molecular weight of 230.26 g/mol. Its IUPAC name is [2,2-difluoro-1-(2-methoxy-4,6-dimethylphenyl)ethyl]hydrazine.
| Compound Name | [2,2-difluoro-1-(2-methoxy-4,6-dimethylphenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 106682824 |
| Molecular Formula | C11H16F2N2O |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | [2,2-difluoro-1-(2-methoxy-4,6-dimethylphenyl)ethyl]hydrazine |
| SMILES | COc1cc(C)cc(C)c1C(NN)C(F)F |
| InChI | InChI=1S/C11H16F2N2O/c1-6-4-7(2)9(8(5-6)16-3)10(15-14)11(12)13/h4-5,10-11,15H,14H2,1-3H3 |
| InChIKey | IGAJMKOYCJIFQJ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|