About methyl 8-[(9,10-dioxophenanthren-2-yl)amino]-8-oxooctanoate
methyl 8-[(9,10-dioxophenanthren-2-yl)amino]-8-oxooctanoate (PubChem CID 10668284) has the molecular formula C23H23NO5
and a molecular weight of 393.44 g/mol. Its IUPAC name is methyl 8-[(9,10-dioxophenanthren-2-yl)amino]-8-oxooctanoate.
Molecular Properties
| Compound Name | methyl 8-[(9,10-dioxophenanthren-2-yl)amino]-8-oxooctanoate |
| PubChem CID | 10668284 |
| Molecular Formula | C23H23NO5 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | methyl 8-[(9,10-dioxophenanthren-2-yl)amino]-8-oxooctanoate |
| SMILES | COC(=O)CCCCCCC(=O)Nc1ccc2c(c1)C(=O)C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C23H23NO5/c1-29-21(26)11-5-3-2-4-10-20(25)24-15-12-13-17-16-8-6-7-9-18(16)22(27)23(28)19(17)14-15/h6-9,12-14H,2-5,10-11H2,1H3,(H,24,25) |
| InChIKey | AVAFSDMMBPCFKE-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze methyl 8-[(9,10-dioxophenanthren-2-yl)amino]-8-oxooctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 8-[(9,10-dioxophenanthren-2-yl)amino]-8-oxooctanoate?
The IUPAC name of methyl 8-[(9,10-dioxophenanthren-2-yl)amino]-8-oxooctanoate (CID 10668284) is methyl 8-[(9,10-dioxophenanthren-2-yl)amino]-8-oxooctanoate.
What is the SMILES notation for methyl 8-[(9,10-dioxophenanthren-2-yl)amino]-8-oxooctanoate?
The canonical SMILES for methyl 8-[(9,10-dioxophenanthren-2-yl)amino]-8-oxooctanoate is COC(=O)CCCCCCC(=O)Nc1ccc2c(c1)C(=O)C(=O)c1ccccc1-2.
What is the InChIKey of methyl 8-[(9,10-dioxophenanthren-2-yl)amino]-8-oxooctanoate?
The InChIKey is AVAFSDMMBPCFKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23NO5/c1-29-21(26)11-5-3-2-4-10-20(25)24-15-12-13-17-16-8-6-7-9-18(16)22(27)23(28)19(17)14-15/h6-9,12-14H,2-5,10-11H2,1H3,(H,24,25).
What are the key properties of methyl 8-[(9,10-dioxophenanthren-2-yl)amino]-8-oxooctanoate?
methyl 8-[(9,10-dioxophenanthren-2-yl)amino]-8-oxooctanoate has a molecular weight of 393.44 g/mol, XLogP of 4.18, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 8-[(9,10-dioxophenanthren-2-yl)amino]-8-oxooctanoate is sourced from PubChem (CID 10668284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).