C13H16ClNO5 — CID 106683480
3-[1-(2-chlorofuran-3-carbonyl)piperidin-4-yl]oxypropanoic acid (PubChem CID 106683480) has the molecular formula C13H16ClNO5 and a molecular weight of 301.73 g/mol. Its IUPAC name is 3-[1-(2-chlorofuran-3-carbonyl)piperidin-4-yl]oxypropanoic acid.
| Compound Name | 3-[1-(2-chlorofuran-3-carbonyl)piperidin-4-yl]oxypropanoic acid |
|---|---|
| PubChem CID | 106683480 |
| Molecular Formula | C13H16ClNO5 |
| Molecular Weight | 301.73 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 3-[1-(2-chlorofuran-3-carbonyl)piperidin-4-yl]oxypropanoic acid |
| SMILES | O=C(O)CCOC1CCN(C(=O)c2ccoc2Cl)CC1 |
| InChI | InChI=1S/C13H16ClNO5/c14-12-10(3-7-20-12)13(18)15-5-1-9(2-6-15)19-8-4-11(16)17/h3,7,9H,1-2,4-6,8H2,(H,16,17) |
| InChIKey | ZLWQAMFWXSCQCB-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.73 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |