C15H17Cl2NO2 — CID 106684608
N-[(5-chlorofuran-2-yl)-(5-chloro-2-methoxyphenyl)methyl]propan-1-amine (PubChem CID 106684608) has the molecular formula C15H17Cl2NO2 and a molecular weight of 314.21 g/mol. Its IUPAC name is N-[(5-chlorofuran-2-yl)-(5-chloro-2-methoxyphenyl)methyl]propan-1-amine.
| Compound Name | N-[(5-chlorofuran-2-yl)-(5-chloro-2-methoxyphenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 106684608 |
| Molecular Formula | C15H17Cl2NO2 |
| Molecular Weight | 314.21 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | N-[(5-chlorofuran-2-yl)-(5-chloro-2-methoxyphenyl)methyl]propan-1-amine |
| SMILES | CCCNC(c1ccc(Cl)o1)c1cc(Cl)ccc1OC |
| InChI | InChI=1S/C15H17Cl2NO2/c1-3-8-18-15(13-6-7-14(17)20-13)11-9-10(16)4-5-12(11)19-2/h4-7,9,15,18H,3,8H2,1-2H3 |
| InChIKey | UIRMJXQSBOVSDW-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.21 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |