About N'-[(2-chlorofuran-3-yl)methyl]-N'-methylethane-1,2-diamine
N'-[(2-chlorofuran-3-yl)methyl]-N'-methylethane-1,2-diamine (PubChem CID 106684725) has the molecular formula C8H13ClN2O
and a molecular weight of 188.66 g/mol. Its IUPAC name is N'-[(2-chlorofuran-3-yl)methyl]-N'-methylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-[(2-chlorofuran-3-yl)methyl]-N'-methylethane-1,2-diamine |
| PubChem CID | 106684725 |
| Molecular Formula | C8H13ClN2O |
| Molecular Weight | 188.66 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | N'-[(2-chlorofuran-3-yl)methyl]-N'-methylethane-1,2-diamine |
| SMILES | CN(CCN)Cc1ccoc1Cl |
| InChI | InChI=1S/C8H13ClN2O/c1-11(4-3-10)6-7-2-5-12-8(7)9/h2,5H,3-4,6,10H2,1H3 |
| InChIKey | ZSYXSKWSSPZEOP-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 42.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.66 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N'-[(2-chlorofuran-3-yl)methyl]-N'-methylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(2-chlorofuran-3-yl)methyl]-N'-methylethane-1,2-diamine?
The IUPAC name of N'-[(2-chlorofuran-3-yl)methyl]-N'-methylethane-1,2-diamine (CID 106684725) is N'-[(2-chlorofuran-3-yl)methyl]-N'-methylethane-1,2-diamine.
What is the SMILES notation for N'-[(2-chlorofuran-3-yl)methyl]-N'-methylethane-1,2-diamine?
The canonical SMILES for N'-[(2-chlorofuran-3-yl)methyl]-N'-methylethane-1,2-diamine is CN(CCN)Cc1ccoc1Cl.
What is the InChIKey of N'-[(2-chlorofuran-3-yl)methyl]-N'-methylethane-1,2-diamine?
The InChIKey is ZSYXSKWSSPZEOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13ClN2O/c1-11(4-3-10)6-7-2-5-12-8(7)9/h2,5H,3-4,6,10H2,1H3.
What are the key properties of N'-[(2-chlorofuran-3-yl)methyl]-N'-methylethane-1,2-diamine?
N'-[(2-chlorofuran-3-yl)methyl]-N'-methylethane-1,2-diamine has a molecular weight of 188.66 g/mol, XLogP of 1.32, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(2-chlorofuran-3-yl)methyl]-N'-methylethane-1,2-diamine is sourced from PubChem (CID 106684725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).