About N'-[(5-chlorofuran-2-yl)methyl]-N'-methyl-N-propylethane-1,2-diamine
N'-[(5-chlorofuran-2-yl)methyl]-N'-methyl-N-propylethane-1,2-diamine (PubChem CID 106684730) has the molecular formula C11H19ClN2O
and a molecular weight of 230.74 g/mol. Its IUPAC name is N'-[(5-chlorofuran-2-yl)methyl]-N'-methyl-N-propylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-[(5-chlorofuran-2-yl)methyl]-N'-methyl-N-propylethane-1,2-diamine |
| PubChem CID | 106684730 |
| Molecular Formula | C11H19ClN2O |
| Molecular Weight | 230.74 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | N'-[(5-chlorofuran-2-yl)methyl]-N'-methyl-N-propylethane-1,2-diamine |
| SMILES | CCCNCCN(C)Cc1ccc(Cl)o1 |
| InChI | InChI=1S/C11H19ClN2O/c1-3-6-13-7-8-14(2)9-10-4-5-11(12)15-10/h4-5,13H,3,6-9H2,1-2H3 |
| InChIKey | JSWQKOABPJOVAK-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.74 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-[(5-chlorofuran-2-yl)methyl]-N'-methyl-N-propylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(5-chlorofuran-2-yl)methyl]-N'-methyl-N-propylethane-1,2-diamine?
The IUPAC name of N'-[(5-chlorofuran-2-yl)methyl]-N'-methyl-N-propylethane-1,2-diamine (CID 106684730) is N'-[(5-chlorofuran-2-yl)methyl]-N'-methyl-N-propylethane-1,2-diamine.
What is the SMILES notation for N'-[(5-chlorofuran-2-yl)methyl]-N'-methyl-N-propylethane-1,2-diamine?
The canonical SMILES for N'-[(5-chlorofuran-2-yl)methyl]-N'-methyl-N-propylethane-1,2-diamine is CCCNCCN(C)Cc1ccc(Cl)o1.
What is the InChIKey of N'-[(5-chlorofuran-2-yl)methyl]-N'-methyl-N-propylethane-1,2-diamine?
The InChIKey is JSWQKOABPJOVAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19ClN2O/c1-3-6-13-7-8-14(2)9-10-4-5-11(12)15-10/h4-5,13H,3,6-9H2,1-2H3.
What are the key properties of N'-[(5-chlorofuran-2-yl)methyl]-N'-methyl-N-propylethane-1,2-diamine?
N'-[(5-chlorofuran-2-yl)methyl]-N'-methyl-N-propylethane-1,2-diamine has a molecular weight of 230.74 g/mol, XLogP of 2.36, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(5-chlorofuran-2-yl)methyl]-N'-methyl-N-propylethane-1,2-diamine is sourced from PubChem (CID 106684730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).