C26H23NO3 — CID 10668505
ethyl 5-oxo-2-phenyl-4-(2-phenylethynyl)-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 10668505) has the molecular formula C26H23NO3 and a molecular weight of 397.47 g/mol. Its IUPAC name is ethyl 5-oxo-2-phenyl-4-(2-phenylethynyl)-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | ethyl 5-oxo-2-phenyl-4-(2-phenylethynyl)-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 10668505 |
| Molecular Formula | C26H23NO3 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | ethyl 5-oxo-2-phenyl-4-(2-phenylethynyl)-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)NC2=C(C(=O)CCC2)C1C#Cc1ccccc1 |
| InChI | InChI=1S/C26H23NO3/c1-2-30-26(29)24-20(17-16-18-10-5-3-6-11-18)23-21(14-9-15-22(23)28)27-25(24)19-12-7-4-8-13-19/h3-8,10-13,20,27H,2,9,14-15H2,1H3 |
| InChIKey | BZPRMLITCVRRND-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|